Seselin

Chemex ID: 123
Empirical Formula: C14H12O3
Molecular weight: 228.25 g/mol

SMILES: O=C1OC2=C3C(OC(C)(C)C=C3)=CC=C2C=C1
InChi: InChI=1S/C14H12O3/c1-14(2)8-7-10-11(17-14)5-3-9-4-6-12(15)16-13(9)10/h3-8H,1-2H3
InChiKey: QUVCQYQEIOLHFZ-UHFFFAOYSA-N