(±)-Murracarpin

Chemex ID: 125
Empirical Formula: C16H18O5
Molecular weight: 290.32 g/mol

SMILES: O=C1OC2=C([C@@H](OC)[C@@H](O)C(C)=C)C(OC)=CC=C2C=C1
InChi: InChI=1S/C16H18O5/c1-9(2)14(18)16(20-4)13-11(19-3)7-5-10-6-8-12(17)21-15(10)13/h5-8,14,16,18H,1H2,2-4H3/t14-,16?/m0/s1
InChiKey: DBPWCIPDCMVUFT-LBAUFKAWSA-N