Alosin

Chemex ID: 126
Empirical Formula: C15H14O4
Molecular weight: 258.27 g/mol

SMILES: O=C1OC2=C(C3C(O3)C(C)=C)C(OC)=CC=C2C=C1
InChi: InChI=1S/C15H14O4/c1-8(2)13-15(19-13)12-10(17-3)6-4-9-5-7-11(16)18-14(9)12/h4-7,13,15H,1H2,2-3H3
InChiKey: YTDNHMHONBWCBV-UHFFFAOYSA-N