Polygodial

Chemex ID: 127
Empirical Formula: C15H22O2
Molecular weight: 234.34 g/mol

SMILES: C[C@@]12[C@](CC=C(C([H])=O)[C@@H]2C([H])=O)([H])C(C)(C)CCC1
InChi: InChI=1S/C15H22O2/c1-14(2)7-4-8-15(3)12(10-17)11(9-16)5-6-13(14)15/h5,9-10,12-13H,4,6-8H2,1-3H3/t12-,13-,15+/m0/s1
InChiKey: AZJUJOFIHHNCSV-KCQAQPDRSA-N