Yuehgesin

Chemex ID: 128
Empirical Formula: C16H20O5
Molecular weight: 292.33 g/mol

SMILES: CC(C)(OC)[C@@H](O)CC1=C(OC(C=C2)=O)C2=CC=C1OC
InChi: InChI=1S/C16H20O5/c1-16(2,20-4)13(17)9-11-12(19-3)7-5-10-6-8-14(18)21-15(10)11/h5-8,13,17H,9H2,1-4H3/t13-/m0/s1
InChiKey: VRCXJKSBSNVDFC-ZDUSSCGKSA-N