Molecule 56

Chemex ID: 129
Empirical Formula: C20H30O2
Molecular weight: 302.46 g/mol

SMILES: O[C@@H]1CC(C)(C)[C@](CC=C(C)[C@H]2CCC3=COC=C3)([H])[C@@]2(C)C1
InChi: InChI=1S/C20H30O2/c1-14-5-8-18-19(2,3)11-16(21)12-20(18,4)17(14)7-6-15-9-10-22-13-15/h5,9-10,13,16-18,21H,6-8,11-12H2,1-4H3/t16-,17-,18-,20+/m1/s1
InChiKey: PUZXGIDPVSUYPY-MLYOOKFZSA-N