Molecule 57

Chemex ID: 130
Empirical Formula: C20H30O2
Molecular weight: 302.46 g/mol

SMILES: CC1(C)[C@@H](O)CC[C@]2(C)[C@]1([H])CC=C(C)[C@H]2CCC3=COC=C3
InChi: InChI=1S/C20H30O2/c1-14-5-8-17-19(2,3)18(21)9-11-20(17,4)16(14)7-6-15-10-12-22-13-15/h5,10,12-13,16-18,21H,6-9,11H2,1-4H3/t16-,17-,18+,20+/m1/s1
InChiKey: WOWBZVWYOQOVBM-XSYGEPLQSA-N