Trachypleuranin

Chemex ID: 131
Empirical Formula: C16H20O5
Molecular weight: 292.33 g/mol

SMILES: O=C1OC2=CC(OC)=C(C[C@@H](O)C(C)(OC)C)C=C2C=C1
InChi: InChI=1S/C16H20O5/c1-16(2,20-4)14(17)8-11-7-10-5-6-15(18)21-13(10)9-12(11)19-3/h5-7,9,14,17H,8H2,1-4H3/t14-/m1/s1
InChiKey: DMWGHNQNZLYMJE-CQSZACIVSA-N