Meranzin

Chemex ID: 132
Empirical Formula: C15H16O4
Molecular weight: 260.29 g/mol

SMILES: CC(C)(O1)[C@@H]1CC2=C(OC(C=C3)=O)C3=CC=C2OC
InChi: InChI=1S/C15H16O4/c1-15(2)12(19-15)8-10-11(17-3)6-4-9-5-7-13(16)18-14(9)10/h4-7,12H,8H2,1-3H3/t12-/m0/s1
InChiKey: LSZONYLDFHGRDP-LBPRGKRZSA-N