Molecule 60

Chemex ID: 133
Empirical Formula: C19H28O3
Molecular weight: 304.43 g/mol

SMILES: C[C@@]12[C@](CC=C(/C=C/C(OCC)=O)[C@@H]2C([H])=O)([H])C(C)(C)CCC1
InChi: InChI=1S/C19H28O3/c1-5-22-17(21)10-8-14-7-9-16-18(2,3)11-6-12-19(16,4)15(14)13-20/h7-8,10,13,15-16H,5-6,9,11-12H2,1-4H3/b10-8+/t15-,16-,19+/m0/s1
InChiKey: UNNYZVNPXLMGJJ-QADFFOFYSA-N