Molecule 61

Chemex ID: 134
Empirical Formula: C15H22N2
Molecular weight: 230.36 g/mol

SMILES: C[C@@]12[C@](CCC3=CN=NC=C32)([H])C(C)(C)CCC1
InChi: InChI=1S/C15H22N2/c1-14(2)7-4-8-15(3)12-10-17-16-9-11(12)5-6-13(14)15/h9-10,13H,4-8H2,1-3H3/t13-,15+/m0/s1
InChiKey: OAOZUIZPPDRFFH-DZGCQCFKSA-N