Drimendiol

Chemex ID: 135
Empirical Formula: C15H26O2
Molecular weight: 238.37 g/mol

SMILES: C[C@@]12[C@](CC=C(CO)[C@@H]2CO)([H])C(C)(C)CCC1
InChi: InChI=1S/C15H26O2/c1-14(2)7-4-8-15(3)12(10-17)11(9-16)5-6-13(14)15/h5,12-13,16-17H,4,6-10H2,1-3H3/t12-,13-,15+/m0/s1
InChiKey: KUTDAKOPPDXZDV-KCQAQPDRSA-N