(-)-Drimenol

Chemex ID: 136
Empirical Formula: C15H26O2
Molecular weight: 222.37 g/mol

SMILES: C[C@@]12[C@](CC=C(C)[C@@H]2CO)([H])C(C)(C)CCC1
InChi: InChI=1S/C15H26O/c1-11-6-7-13-14(2,3)8-5-9-15(13,4)12(11)10-16/h6,12-13,16H,5,7-10H2,1-4H3/t12-,13-,15+/m0/s1
InChiKey: HMWSKUKBAWWOJL-KCQAQPDRSA-N