Molecule 70

Chemex ID: 144
Empirical Formula: C20H25NO5
Molecular weight: 359.42 g/mol

SMILES: O=C(C1=C(C)NC(C)=C(C(OCC)=O)C1C2=CC=C(OC)C=C2)OCC
InChi: InChI=1S/C20H25NO5/c1-6-25-19(22)16-12(3)21-13(4)17(20(23)26-7-2)18(16)14-8-10-15(24-5)11-9-14/h8-11,18,21H,6-7H2,1-5H3
InChiKey: QCJJMPZWBYORGR-UHFFFAOYSA-N