Molecule 71

Chemex ID: 145
Empirical Formula: C21H27NO5
Molecular weight: 373.45 g/mol

SMILES: CN1C(C)=C(C(OCC)=O)C(C2=CC=C(OC)C=C2)C(C(OCC)=O)=C1C
InChi: InChI=1S/C21H27NO5/c1-7-26-20(23)17-13(3)22(5)14(4)18(21(24)27-8-2)19(17)15-9-11-16(25-6)12-10-15/h9-12,19H,7-8H2,1-6H3
InChiKey: NHVAYSIVSNXLGM-UHFFFAOYSA-N