Molecule 72

Chemex ID: 146
Empirical Formula: C20H24N2O6
Molecular weight: 388.42 g/mol

SMILES: O=C(C1=C(C)N(C)C(C)=C(C(OCC)=O)C1C2=CC=C([N+]([O-])=O)C=C2)OCC
InChi: InChI=1S/C20H24N2O6/c1-6-27-19(23)16-12(3)21(5)13(4)17(20(24)28-7-2)18(16)14-8-10-15(11-9-14)22(25)26/h8-11,18H,6-7H2,1-5H3
InChiKey: GZNAAUQSWVWZSW-UHFFFAOYSA-N