Molecule 73

Chemex ID: 147
Empirical Formula: C18H22N2O4
Molecular weight: 330.38 g/mol

SMILES: O=C(C1=C(C)NC(C)=C(C(OCC)=O)C1C2=NC=CC=C2)OCC
InChi: InChI=1S/C18H22N2O4/c1-5-23-17(21)14-11(3)20-12(4)15(18(22)24-6-2)16(14)13-9-7-8-10-19-13/h7-10,16,20H,5-6H2,1-4H3
InChiKey: RDWSCKBHQLBBSE-UHFFFAOYSA-N