Molecule 74

Chemex ID: 148
Empirical Formula: C19H24N2O4
Molecular weight: 344.41 g/mol

SMILES: O=C(C1=C(C)N(C)C(C)=C(C(OCC)=O)C1C2=NC=CC=C2)OCC
InChi: InChI=1S/C19H24N2O4/c1-6-24-18(22)15-12(3)21(5)13(4)16(19(23)25-7-2)17(15)14-10-8-9-11-20-14/h8-11,17H,6-7H2,1-5H3
InChiKey: CXVIDBBACGACBG-UHFFFAOYSA-N