Molecule 75

Chemex ID: 149
Empirical Formula: C17H21NO5
Molecular weight: 319.36 g/mol

SMILES: O=C(C1=C(C)NC(C)=C(C(OCC)=O)C1C2=CC=CO2)OCC
InChi: InChI=1S/C17H21NO5/c1-5-21-16(19)13-10(3)18-11(4)14(17(20)22-6-2)15(13)12-8-7-9-23-12/h7-9,15,18H,5-6H2,1-4H3
InChiKey: QEHKCWCTQOSUOP-UHFFFAOYSA-N