Molecule 76

Chemex ID: 150
Empirical Formula: C27H29NO6
Molecular weight: 463.53 g/mol

SMILES: C=C1C(C2=CC(OCO3)=C3C=C2)(C(OCC)=O)C(C4=CC=CC=C4)C(C(OCC)=O)=C(C)N1C
InChi: InChI=1S/C27H29NO6/c1-6-31-25(29)23-17(3)28(5)18(4)27(26(30)32-7-2,24(23)19-11-9-8-10-12-19)20-13-14-21-22(15-20)34-16-33-21/h8-15,24H,4,6-7,16H2,1-3,5H3
InChiKey: PMIULSWRILXJFA-UHFFFAOYSA-N