Molecule 77

Chemex ID: 151
Empirical Formula: C27H31NO5
Molecular weight: 449.55 g/mol

SMILES: C=C1C(C(OCC)=O)(C2=CC=CC=C2)C(C3=CC=C(OC)C=C3)C(C(OCC)=O)=C(C)N1C
InChi: InChI=1S/C27H31NO5/c1-7-32-25(29)23-18(3)28(5)19(4)27(26(30)33-8-2,21-12-10-9-11-13-21)24(23)20-14-16-22(31-6)17-15-20/h9-17,24H,4,7-8H2,1-3,5-6H3
InChiKey: PUXGSHKIZGSSKJ-UHFFFAOYSA-N