Molecule 78

Chemex ID: 152
Empirical Formula: C19H29NO4
Molecular weight: 335.44 g/mol

SMILES: O=C(C1=C(C)NC(C)=C(C(OCC)=O)C1C2CCCCC2)OCC
InChi: InChI=1S/C19H29NO4/c1-5-23-18(21)15-12(3)20-13(4)16(19(22)24-6-2)17(15)14-10-8-7-9-11-14/h14,17,20H,5-11H2,1-4H3
InChiKey: GERWBKSVDHUVIT-UHFFFAOYSA-N