Molecule 79

Chemex ID: 153
Empirical Formula: C20H31NO4
Molecular weight: 349.47 g/mol

SMILES: O=C(C1=C(C)N(C)C(C)=C(C(OCC)=O)C1C2CCCCC2)OCC
InChi: InChI=1S/C20H31NO4/c1-6-24-19(22)16-13(3)21(5)14(4)17(20(23)25-7-2)18(16)15-11-9-8-10-12-15/h15,18H,6-12H2,1-5H3
InChiKey: VNUWLWLVKFUYJB-UHFFFAOYSA-N