Molecule 80

Chemex ID: 154
Empirical Formula: C18H23NO5
Molecular weight: 333.38 g/mol

SMILES: O=C(C1=C(C)N(C)C(C)=C(C(OCC)=O)C1C2=CC=CO2)OCC
InChi: InChI=1S/C18H23NO5/c1-6-22-17(20)14-11(3)19(5)12(4)15(18(21)23-7-2)16(14)13-9-8-10-24-13/h8-10,16H,6-7H2,1-5H3
InChiKey: TVXQKQCNUHDLGR-UHFFFAOYSA-N