Molecule 81

Chemex ID: 155
Empirical Formula: C32H33NO6
Molecular weight: 527.62 g/mol

SMILES: O=C(C1=CC(C(OCC)=O)=C(C2=CC=C(OC)C=C2)N(C)C1(C3=CC=C(OC)C=C3)C4=CC=CC=C4)OCC
InChi: InChI=1S/C32H33NO6/c1-6-38-30(34)27-21-28(31(35)39-7-2)32(23-11-9-8-10-12-23,24-15-19-26(37-5)20-16-24)33(3)29(27)22-13-17-25(36-4)18-14-22/h8-21H,6-7H2,1-5H3
InChiKey: IKDKUNKIIPUQNI-UHFFFAOYSA-N