Molecule 82

Chemex ID: 156
Empirical Formula: C30H27Br2NO4
Molecular weight: 625.36 g/mol

SMILES: BrC(C=C1)=CC=C1C2=C(C(OCC)=O)C=C(C(OCC)=O)C(C3=CC=C(Br)C=C3)(C4=CC=CC=C4)N2C
InChi: InChI=1S/C30H27Br2NO4/c1-4-36-28(34)25-19-26(29(35)37-5-2)30(21-9-7-6-8-10-21,22-13-17-24(32)18-14-22)33(3)27(25)20-11-15-23(31)16-12-20/h6-19H,4-5H2,1-3H3
InChiKey: MNMDCJNRIFYVIS-UHFFFAOYSA-N