Molecule 84

Chemex ID: 158
Empirical Formula: C30H31NO5
Molecular weight: 485.58 g/mol

SMILES: O=C(C1=C(C)N(C)C(C)=C(C(OCC)=O)C1[C@]2(O3)C4=CC=CC=C4[C@@H]3C5C2C6=C5C=CC=C6)OCC
InChi: InChI=1S/C30H31NO5/c1-6-34-28(32)22-16(3)31(5)17(4)23(29(33)35-7-2)26(22)30-21-15-11-10-14-20(21)27(36-30)24-18-12-8-9-13-19(18)25(24)30/h8-15,24-27H,6-7H2,1-5H3/t24?,25?,27-,30+/m1/s1
InChiKey: XMXIOCYDHHASCE-YJLDUJAISA-N