Molecule 85

Chemex ID: 159
Empirical Formula: C25H33NO4
Molecular weight: 411.54 g/mol

SMILES: O=C(OCC)[C@@]1(C2=CC=CC=C2)C(N(C)C(C)=C(C(OCC)=O)[C@@H]1C3CCCC3)=C
InChi: InChI=1S/C25H33NO4/c1-6-29-23(27)21-17(3)26(5)18(4)25(24(28)30-7-2,20-15-9-8-10-16-20)22(21)19-13-11-12-14-19/h8-10,15-16,19,22H,4,6-7,11-14H2,1-3,5H3/t22-,25?/m0/s1
InChiKey: ZBYVOCYJDVBVNT-XADRRFQNSA-N