Molecule 86

Chemex ID: 160
Empirical Formula: C31H37NO4
Molecular weight: 487.64 g/mol

SMILES: O=C(OCC)[C@@]1(C2=CC=CC=C2)[C@@]3(CC4=C3C=CC=C4)N(C)C(C)=C(C(OCC)=O)[C@@H]1C5CCCC5
InChi: InChI=1S/C31H37NO4/c1-5-35-28(33)26-21(3)32(4)30(20-23-16-12-13-19-25(23)30)31(29(34)36-6-2,24-17-8-7-9-18-24)27(26)22-14-10-11-15-22/h7-9,12-13,16-19,22,27H,5-6,10-11,14-15,20H2,1-4H3/t27-,30-,31?/m0/s1