Molecule 88

Chemex ID: 162
Empirical Formula: C23H29NO4
Molecular weight: 383.49 g/mol

SMILES: O=C(OCC)[C@@]1(C2=CC=CC=C2)C(N(C)C(C)=C(C(OCC)=O)[C@@H]1C3CC3)=C
InChi: InChI=1S/C23H29NO4/c1-6-27-21(25)19-15(3)24(5)16(4)23(22(26)28-7-2,20(19)17-13-14-17)18-11-9-8-10-12-18/h8-12,17,20H,4,6-7,13-14H2,1-3,5H3/t20-,23?/m0/s1
InChiKey: ZDSSMUVKNAEXQV-AJZOCDQUSA-N