Molecule 89

Chemex ID: 163
Empirical Formula: C23H31NO4
Molecular weight: 385.5 g/mol

SMILES: O=C(OCC)[C@@]1(C2=CC=CC=C2)C(N(C)C(C)=C(C(OCC)=O)[C@H]1CCC)=C
InChi: InChI=1S/C23H31NO4/c1-7-13-19-20(21(25)27-8-2)16(4)24(6)17(5)23(19,22(26)28-9-3)18-14-11-10-12-15-18/h10-12,14-15,19H,5,7-9,13H2,1-4,6H3/t19-,23?/m1/s1
InChiKey: RWKHCNXYVAUGFS-HWYAHNCWSA-N