Molecule 90

Chemex ID: 164
Empirical Formula: C18H18N2
Molecular weight: 262.36 g/mol

SMILES: N#CCC(C(C=CC=C1)=C1CC2)N2CC3=CC=CC=C3
InChi: InChI=1S/C18H18N2/c19-12-10-18-17-9-5-4-8-16(17)11-13-20(18)14-15-6-2-1-3-7-15/h1-9,18H,10-11,13-14H2
InChiKey: XCTBKLONTAXNRU-UHFFFAOYSA-N