Molecule 91

Chemex ID: 165
Empirical Formula: C18H17BrN2
Molecular weight: 341.25 g/mol

SMILES: BrC(C=C1)=CC2=C1CCN(C2CC#N)CC3=CC=CC=C3
InChi: InChI=1S/C18H17BrN2/c19-16-7-6-15-9-11-21(13-14-4-2-1-3-5-14)18(8-10-20)17(15)12-16/h1-7,12,18H,8-9,11,13H2
InChiKey: XQJDVTBTBHOHSX-UHFFFAOYSA-N