Molecule 92

Chemex ID: 166
Empirical Formula: C19H20N2O
Molecular weight: 292.38 g/mol

SMILES: N#CCC(C(C=CC=C1)=C1CC2)N2CC3=CC=C(OC)C=C3
InChi: InChI=1S/C19H20N2O/c1-22-17-8-6-15(7-9-17)14-21-13-11-16-4-2-3-5-18(16)19(21)10-12-20/h2-9,19H,10-11,13-14H2,1H3
InChiKey: IGGHOHNBVCXKTG-UHFFFAOYSA-N