Molecule 93

Chemex ID: 167
Empirical Formula: C17H24N2O
Molecular weight: 272.39 g/mol

SMILES: CN(C1(CCCCC1)CC#N)CC2=CC=C(OC)C=C2
InChi: InChI=1S/C17H24N2O/c1-19(14-15-6-8-16(20-2)9-7-15)17(12-13-18)10-4-3-5-11-17/h6-9H,3-5,10-12,14H2,1-2H3
InChiKey: XPLMHQQPIWRFSW-UHFFFAOYSA-N