Molecule 94

Chemex ID: 168
Empirical Formula: C19H24NO4P
Molecular weight: 361.38 g/mol

SMILES: O=P(C(C(C=CC=C1)=C1CC2)N2CC3=CC=C(OC)C=C3)(OC)OC
InChi: InChI=1S/C19H24NO4P/c1-22-17-10-8-15(9-11-17)14-20-13-12-16-6-4-5-7-18(16)19(20)25(21,23-2)24-3/h4-11,19H,12-14H2,1-3H3
InChiKey: GOQFNWRHSPGJQE-UHFFFAOYSA-N