Molecule 95

Chemex ID: 169
Empirical Formula: C14H17NO
Molecular weight: 215.3 g/mol

SMILES: CC(C)(C)C1=NC=C(CC2=CC=CC=C2)O1
InChi: InChI=1S/C14H17NO/c1-14(2,3)13-15-10-12(16-13)9-11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3
InChiKey: JTGFOFNMLHRFGU-UHFFFAOYSA-N