Molecule 96

Chemex ID: 170
Empirical Formula: C25H24O
Molecular weight: 340.47 g/mol

SMILES: CC(C)(C)C1(O2)C3=C(C=CC=C3)C2(CC4=CC=CC=C4)C5=CC=CC=C51
InChi: InChI=1S/C25H24O/c1-23(2,3)25-21-15-9-7-13-19(21)24(26-25,17-18-11-5-4-6-12-18)20-14-8-10-16-22(20)25/h4-16H,17H2,1-3H3
InChiKey: JWIUTMJTPURVDU-UHFFFAOYSA-N