Molecule 97

Chemex ID: 171
Empirical Formula: C25H24
Molecular weight: 324.47 g/mol

SMILES: CC(C)(C)C1=C2C(C=CC=C2)=C(CC3=CC=CC=C3)C4=CC=CC=C41
InChi: InChI=1S/C25H24/c1-25(2,3)24-21-15-9-7-13-19(21)23(17-18-11-5-4-6-12-18)20-14-8-10-16-22(20)24/h4-16H,17H2,1-3H3
InChiKey: PKAABAQRDKMXDG-UHFFFAOYSA-N