Molecule 355

Chemex ID: 416
Empirical Formula: C21H20N2
Molecular weight: 300.41 g/mol

SMILES: C12=CC=CC=C1N(C3=CC=CC=C3)CCN(C4=CC=CC=C4)C2
InChi: InChI=1S/C21H20N2/c1-3-10-19(11-4-1)22-15-16-23(20-12-5-2-6-13-20)21-14-8-7-9-18(21)17-22/h1-14H,15-17H2
InChiKey: XWKREYYORXWUTG-UHFFFAOYSA-N