Molecule 356

Chemex ID: 417
Empirical Formula: C20H24N2O2
Molecular weight: 324.42 g/mol

SMILES: CC(OC(N1CC2=CC=CC=C2N(C3=CC=CC=C3)CC1)=O)(C)C
InChi: InChI=1S/C20H24N2O2/c1-20(2,3)24-19(23)21-13-14-22(17-10-5-4-6-11-17)18-12-8-7-9-16(18)15-21/h4-12H,13-15H2,1-3H3
InChiKey: AAWYVLQBWJYEOV-UHFFFAOYSA-N