Molecule 357

Chemex ID: 418
Empirical Formula: C15H22N2O2
Molecular weight: 262.35 g/mol

SMILES: CC(OC(N1CC2=CC=CC=C2N(C)CC1)=O)(C)C
InChi: InChI=1S/C15H22N2O2/c1-15(2,3)19-14(18)17-10-9-16(4)13-8-6-5-7-12(13)11-17/h5-8H,9-11H2,1-4H3
InChiKey: CFUWWGPOSSEVMN-UHFFFAOYSA-N