Molecule 358

Chemex ID: 419
Empirical Formula: C27H24N2O2
Molecular weight: 408.5 g/mol

SMILES: COC(C=C1)=CC=C1N2C3=C(C=CC=C3)N(C4=CC=C(OC)C=C4)CC5=CC=CC=C52
InChi: InChI=1S/C27H24N2O2/c1-30-23-15-11-21(12-16-23)28-19-20-7-3-4-8-25(20)29(27-10-6-5-9-26(27)28)22-13-17-24(31-2)18-14-22/h3-18H,19H2,1-2H3
InChiKey: PKSIHFUCPVGQQS-UHFFFAOYSA-N