Molecule 359

Chemex ID: 420
Empirical Formula: C22H20N2O2
Molecular weight: 344.41 g/mol

SMILES: C1(OCO2)=C2C=C(CN(C3=CC=CC=C3)CCN4C5=CC=CC=C5)C4=C1
InChi: InChI=1S/C22H20N2O2/c1-3-7-18(8-4-1)23-11-12-24(19-9-5-2-6-10-19)20-14-22-21(25-16-26-22)13-17(20)15-23/h1-10,13-14H,11-12,15-16H2
InChiKey: QNSQBBSKOPFDMO-UHFFFAOYSA-N