Molecule 360

Chemex ID: 421
Empirical Formula: C21H19F5N2O3S
Molecular weight: 486.46 g/mol

SMILES: OS(=O)(C(F)(F)F)=O.FC1=C(F)C=C(CN(C2=CC=CC=C2)CCN3C4=CC=CC=C4)C3=C1
InChi: InChI=1S/C21H18F2N2.CHF3O3S/c22-19-13-16-15-24(17-7-3-1-4-8-17)11-12-25(21(16)14-20(19)23)18-9-5-2-6-10-18;2-1(3,4)8(5,6)7/h1-10,13-14H,11-12,15H2;(H,5,6,7)
InChiKey: IFQGBWJTXNFHHB-UHFFFAOYSA-N