Molecule 361

Chemex ID: 422
Empirical Formula: C15H15NO
Molecular weight: 225.29 g/mol

SMILES: COC1=CC2=C(C=C1)CN(C)C3=C2C=CC=C3
InChi: InChI=1S/C15H15NO/c1-16-10-11-7-8-12(17-2)9-14(11)13-5-3-4-6-15(13)16/h3-9H,10H2,1-2H3
InChiKey: HJIBYOQZXMZPJV-UHFFFAOYSA-N