Molecule 362

Chemex ID: 423
Empirical Formula: C19H21NO3
Molecular weight: 311.38 g/mol

SMILES: COC1=CC2=C(C=C1)CN(C(OC(C)(C)C)=O)C3=C2C=CC=C3
InChi: InChI=1S/C19H21NO3/c1-19(2,3)23-18(21)20-12-13-9-10-14(22-4)11-16(13)15-7-5-6-8-17(15)20/h5-11H,12H2,1-4H3
InChiKey: UJHVRNRZNYLYNQ-UHFFFAOYSA-N