Asperuloside

Chemex ID: 122
Empirical Formula: C18H22O11
Molecular weight: 414.36 g/mol

SMILES: O=C1O[C@@H]2[C@]3([H])C1=CO[C@@]([H])(O[C@H]4[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O4)C3=C(COC(C)=O)C2
InChi: InChI=1S/C18H22O11/c1-6(20)25-4-7-2-9-12-8(16(24)27-9)5-26-17(11(7)12)29-18-15(23)14(22)13(21)10(3-19)28-18/h5,9-10,12-15,17-19,21-23H,2-4H2,1H3/t9-,10+,12-,13+,14-,15+,17-,18-/m0/s1
InChiKey: WOIRAGOFPPSMDO-AYXRPORFSA-N