Epoxysuberosin

Chemex ID: 124
Empirical Formula: C15H1604
Molecular weight: 260.29 g/mol

SMILES: O=C1OC2=CC(OC)=C(C[C@@H](O3)C3(C)C)C=C2C=C1
InChi: InChI=1S/C15H16O4/c1-15(2)13(19-15)7-10-6-9-4-5-14(16)18-12(9)8-11(10)17-3/h4-6,8,13H,7H2,1-3H3/t13-/m1/s1
InChiKey: JZRVCRZHZQXYDH-CYBMUJFWSA-N