Molecule 69

Chemex ID: 143
Empirical Formula: C24H16N4
Molecular weight: 360.42 g/mol

SMILES: N#C/C(C#N)=C(C(C=CC=C1)=C1/C2=C(C#N)/C#N)/C3=C2C=CC(C(C)(C)C)=C3
InChi: InChI=1S/C24H16N4/c1-24(2,3)17-8-9-20-21(10-17)23(16(13-27)14-28)19-7-5-4-6-18(19)22(20)15(11-25)12-26/h4-10H,1-3H3
InChiKey: DLHYFVRJJPFJCD-UHFFFAOYSA-N